methyl 5-oxo-1-(4-oxo-1,3-thiazol-2-yl)pyrrolidine-3-carboxylate

C9H10N2O4S — CID 168694053

IUPACmethyl 5-oxo-1-(4-oxo-1,3-thiazol-2-yl)pyrrolidine-3-carboxylate
SMILESCOC(=O)C1CC(=O)N(C2=NC(=O)CS2)C1
InChIInChI=1S/C9H10N2O4S/c1-15-8(14)5-2-7(13)11(3-5)9-10-6(12)4-16-9/h5H,2-4H2,1H3
InChIKeyGSPSTYXVAVWNAR-UHFFFAOYSA-N
MW242.26 g/mol
LogP-0.36
Rot. Bonds1

About methyl 5-oxo-1-(4-oxo-1,3-thiazol-2-yl)pyrrolidine-3-carboxylate

methyl 5-oxo-1-(4-oxo-1,3-thiazol-2-yl)pyrrolidine-3-carboxylate (PubChem CID 168694053) has the molecular formula C9H10N2O4S and a molecular weight of 242.26 g/mol. Its IUPAC name is methyl 5-oxo-1-(4-oxo-1,3-thiazol-2-yl)pyrrolidine-3-carboxylate.

Molecular Properties

Compound Namemethyl 5-oxo-1-(4-oxo-1,3-thiazol-2-yl)pyrrolidine-3-carboxylate
PubChem CID168694053
Molecular FormulaC9H10N2O4S
Molecular Weight242.26 g/mol
Exact Mass242.04
IUPAC Namemethyl 5-oxo-1-(4-oxo-1,3-thiazol-2-yl)pyrrolidine-3-carboxylate
SMILESCOC(=O)C1CC(=O)N(C2=NC(=O)CS2)C1
InChIInChI=1S/C9H10N2O4S/c1-15-8(14)5-2-7(13)11(3-5)9-10-6(12)4-16-9/h5H,2-4H2,1H3
InChIKeyGSPSTYXVAVWNAR-UHFFFAOYSA-N
XLogP-0.36
TPSA76.04 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds1
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500242.26
LogP ≤ 5-0.36
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze methyl 5-oxo-1-(4-oxo-1,3-thiazol-2-yl)pyrrolidine-3-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 5-oxo-1-(4-oxo-1,3-thiazol-2-yl)pyrrolidine-3-carboxylate?
The IUPAC name of methyl 5-oxo-1-(4-oxo-1,3-thiazol-2-yl)pyrrolidine-3-carboxylate (CID 168694053) is methyl 5-oxo-1-(4-oxo-1,3-thiazol-2-yl)pyrrolidine-3-carboxylate.
What is the SMILES notation for methyl 5-oxo-1-(4-oxo-1,3-thiazol-2-yl)pyrrolidine-3-carboxylate?
The canonical SMILES for methyl 5-oxo-1-(4-oxo-1,3-thiazol-2-yl)pyrrolidine-3-carboxylate is COC(=O)C1CC(=O)N(C2=NC(=O)CS2)C1.
What is the InChIKey of methyl 5-oxo-1-(4-oxo-1,3-thiazol-2-yl)pyrrolidine-3-carboxylate?
The InChIKey is GSPSTYXVAVWNAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2O4S/c1-15-8(14)5-2-7(13)11(3-5)9-10-6(12)4-16-9/h5H,2-4H2,1H3.
What are the key properties of methyl 5-oxo-1-(4-oxo-1,3-thiazol-2-yl)pyrrolidine-3-carboxylate?
methyl 5-oxo-1-(4-oxo-1,3-thiazol-2-yl)pyrrolidine-3-carboxylate has a molecular weight of 242.26 g/mol, XLogP of -0.36, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-oxo-1-(4-oxo-1,3-thiazol-2-yl)pyrrolidine-3-carboxylate is sourced from PubChem (CID 168694053), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).