C13H12N2O2 — CID 168695945
1-(4-ethynylphenyl)-5-oxopyrrolidine-3-carboxamide (PubChem CID 168695945) has the molecular formula C13H12N2O2 and a molecular weight of 228.25 g/mol. Its IUPAC name is 1-(4-ethynylphenyl)-5-oxopyrrolidine-3-carboxamide.
| Compound Name | 1-(4-ethynylphenyl)-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 168695945 |
| Molecular Formula | C13H12N2O2 |
| Molecular Weight | 228.25 g/mol |
| Exact Mass | 228.09 |
| IUPAC Name | 1-(4-ethynylphenyl)-5-oxopyrrolidine-3-carboxamide |
| SMILES | C#Cc1ccc(N2CC(C(N)=O)CC2=O)cc1 |
| InChI | InChI=1S/C13H12N2O2/c1-2-9-3-5-11(6-4-9)15-8-10(13(14)17)7-12(15)16/h1,3-6,10H,7-8H2,(H2,14,17) |
| InChIKey | SNMVQQZYCNHNSB-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.25 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|