C13H16N2O4 — CID 168697856
1-[4-(2-hydroxyethoxy)phenyl]-5-oxopyrrolidine-3-carboxamide (PubChem CID 168697856) has the molecular formula C13H16N2O4 and a molecular weight of 264.28 g/mol. Its IUPAC name is 1-[4-(2-hydroxyethoxy)phenyl]-5-oxopyrrolidine-3-carboxamide.
| Compound Name | 1-[4-(2-hydroxyethoxy)phenyl]-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 168697856 |
| Molecular Formula | C13H16N2O4 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | 1-[4-(2-hydroxyethoxy)phenyl]-5-oxopyrrolidine-3-carboxamide |
| SMILES | NC(=O)C1CC(=O)N(c2ccc(OCCO)cc2)C1 |
| InChI | InChI=1S/C13H16N2O4/c14-13(18)9-7-12(17)15(8-9)10-1-3-11(4-2-10)19-6-5-16/h1-4,9,16H,5-8H2,(H2,14,18) |
| InChIKey | YWFWOKDWTIVXQG-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 92.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |