C13H13N3O3 — CID 168697772
5-oxo-1-(1-oxo-2,3-dihydroisoindol-5-yl)pyrrolidine-3-carboxamide (PubChem CID 168697772) has the molecular formula C13H13N3O3 and a molecular weight of 259.26 g/mol. Its IUPAC name is 5-oxo-1-(1-oxo-2,3-dihydroisoindol-5-yl)pyrrolidine-3-carboxamide.
| Compound Name | 5-oxo-1-(1-oxo-2,3-dihydroisoindol-5-yl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 168697772 |
| Molecular Formula | C13H13N3O3 |
| Molecular Weight | 259.26 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | 5-oxo-1-(1-oxo-2,3-dihydroisoindol-5-yl)pyrrolidine-3-carboxamide |
| SMILES | NC(=O)C1CC(=O)N(c2ccc3c(c2)CNC3=O)C1 |
| InChI | InChI=1S/C13H13N3O3/c14-12(18)8-4-11(17)16(6-8)9-1-2-10-7(3-9)5-15-13(10)19/h1-3,8H,4-6H2,(H2,14,18)(H,15,19) |
| InChIKey | ORYJHFSTMAKGIT-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.26 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |