C16H20ClN3O2 — CID 94077492
(3R)-1-(3-chloro-4-piperidin-1-ylphenyl)-5-oxopyrrolidine-3-carboxamide (PubChem CID 94077492) has the molecular formula C16H20ClN3O2 and a molecular weight of 321.81 g/mol. Its IUPAC name is (3R)-1-(3-chloro-4-piperidin-1-ylphenyl)-5-oxopyrrolidine-3-carboxamide.
| Compound Name | (3R)-1-(3-chloro-4-piperidin-1-ylphenyl)-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 94077492 |
| Molecular Formula | C16H20ClN3O2 |
| Molecular Weight | 321.81 g/mol |
| Exact Mass | 321.12 |
| IUPAC Name | (3R)-1-(3-chloro-4-piperidin-1-ylphenyl)-5-oxopyrrolidine-3-carboxamide |
| SMILES | NC(=O)[C@@H]1CC(=O)N(c2ccc(N3CCCCC3)c(Cl)c2)C1 |
| InChI | InChI=1S/C16H20ClN3O2/c17-13-9-12(20-10-11(16(18)22)8-15(20)21)4-5-14(13)19-6-2-1-3-7-19/h4-5,9,11H,1-3,6-8,10H2,(H2,18,22)/t11-/m1/s1 |
| InChIKey | KMZQNBXVDUHMHK-LLVKDONJSA-N |
| XLogP | 2.17 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.81 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|