C17H21ClN4O3 — CID 50896096
1-[4-(4-acetylpiperazin-1-yl)-3-chlorophenyl]-5-oxopyrrolidine-3-carboxamide (PubChem CID 50896096) has the molecular formula C17H21ClN4O3 and a molecular weight of 364.83 g/mol. Its IUPAC name is 1-[4-(4-acetylpiperazin-1-yl)-3-chlorophenyl]-5-oxopyrrolidine-3-carboxamide.
| Compound Name | 1-[4-(4-acetylpiperazin-1-yl)-3-chlorophenyl]-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 50896096 |
| Molecular Formula | C17H21ClN4O3 |
| Molecular Weight | 364.83 g/mol |
| Exact Mass | 364.13 |
| IUPAC Name | 1-[4-(4-acetylpiperazin-1-yl)-3-chlorophenyl]-5-oxopyrrolidine-3-carboxamide |
| SMILES | CC(=O)N1CCN(c2ccc(N3CC(C(N)=O)CC3=O)cc2Cl)CC1 |
| InChI | InChI=1S/C17H21ClN4O3/c1-11(23)20-4-6-21(7-5-20)15-3-2-13(9-14(15)18)22-10-12(17(19)25)8-16(22)24/h2-3,9,12H,4-8,10H2,1H3,(H2,19,25) |
| InChIKey | ZKLNLFRRJNPGPZ-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 86.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.83 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|