C17H22N4O3 — CID 50879047
1-[4-(4-acetylpiperazin-1-yl)phenyl]-5-oxopyrrolidine-3-carboxamide (PubChem CID 50879047) has the molecular formula C17H22N4O3 and a molecular weight of 330.39 g/mol. Its IUPAC name is 1-[4-(4-acetylpiperazin-1-yl)phenyl]-5-oxopyrrolidine-3-carboxamide.
| Compound Name | 1-[4-(4-acetylpiperazin-1-yl)phenyl]-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 50879047 |
| Molecular Formula | C17H22N4O3 |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | 1-[4-(4-acetylpiperazin-1-yl)phenyl]-5-oxopyrrolidine-3-carboxamide |
| SMILES | CC(=O)N1CCN(c2ccc(N3CC(C(N)=O)CC3=O)cc2)CC1 |
| InChI | InChI=1S/C17H22N4O3/c1-12(22)19-6-8-20(9-7-19)14-2-4-15(5-3-14)21-11-13(17(18)24)10-16(21)23/h2-5,13H,6-11H2,1H3,(H2,18,24) |
| InChIKey | RQLHKNOXNLUTEJ-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 86.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|