C14H13N3O2S — CID 168698569
5-oxo-1-(5-phenyl-1,3-thiazol-2-yl)pyrrolidine-3-carboxamide (PubChem CID 168698569) has the molecular formula C14H13N3O2S and a molecular weight of 287.34 g/mol. Its IUPAC name is 5-oxo-1-(5-phenyl-1,3-thiazol-2-yl)pyrrolidine-3-carboxamide.
| Compound Name | 5-oxo-1-(5-phenyl-1,3-thiazol-2-yl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 168698569 |
| Molecular Formula | C14H13N3O2S |
| Molecular Weight | 287.34 g/mol |
| Exact Mass | 287.07 |
| IUPAC Name | 5-oxo-1-(5-phenyl-1,3-thiazol-2-yl)pyrrolidine-3-carboxamide |
| SMILES | NC(=O)C1CC(=O)N(c2ncc(-c3ccccc3)s2)C1 |
| InChI | InChI=1S/C14H13N3O2S/c15-13(19)10-6-12(18)17(8-10)14-16-7-11(20-14)9-4-2-1-3-5-9/h1-5,7,10H,6,8H2,(H2,15,19) |
| InChIKey | PQJYRLORGAMJBW-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.34 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |