C13H12N2O3 — CID 168703880
4-hydroxy-1-[3-(1,3-oxazol-5-yl)phenyl]pyrrolidin-2-one (PubChem CID 168703880) has the molecular formula C13H12N2O3 and a molecular weight of 244.25 g/mol. Its IUPAC name is 4-hydroxy-1-[3-(1,3-oxazol-5-yl)phenyl]pyrrolidin-2-one.
| Compound Name | 4-hydroxy-1-[3-(1,3-oxazol-5-yl)phenyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 168703880 |
| Molecular Formula | C13H12N2O3 |
| Molecular Weight | 244.25 g/mol |
| Exact Mass | 244.08 |
| IUPAC Name | 4-hydroxy-1-[3-(1,3-oxazol-5-yl)phenyl]pyrrolidin-2-one |
| SMILES | O=C1CC(O)CN1c1cccc(-c2cnco2)c1 |
| InChI | InChI=1S/C13H12N2O3/c16-11-5-13(17)15(7-11)10-3-1-2-9(4-10)12-6-14-8-18-12/h1-4,6,8,11,16H,5,7H2 |
| InChIKey | WOXHRCYQVLSBGB-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 66.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.25 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |