C6H8N4O2 — CID 168704175
4-hydroxy-1-(1H-1,2,4-triazol-5-yl)pyrrolidin-2-one (PubChem CID 168704175) has the molecular formula C6H8N4O2 and a molecular weight of 168.16 g/mol. Its IUPAC name is 4-hydroxy-1-(1H-1,2,4-triazol-5-yl)pyrrolidin-2-one.
| Compound Name | 4-hydroxy-1-(1H-1,2,4-triazol-5-yl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 168704175 |
| Molecular Formula | C6H8N4O2 |
| Molecular Weight | 168.16 g/mol |
| Exact Mass | 168.06 |
| IUPAC Name | 4-hydroxy-1-(1H-1,2,4-triazol-5-yl)pyrrolidin-2-one |
| SMILES | O=C1CC(O)CN1c1ncn[nH]1 |
| InChI | InChI=1S/C6H8N4O2/c11-4-1-5(12)10(2-4)6-7-3-8-9-6/h3-4,11H,1-2H2,(H,7,8,9) |
| InChIKey | LLURCHUTZSUXPU-UHFFFAOYSA-N |
| XLogP | -1.10 |
| TPSA | 82.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.16 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |