C15H21N3O3S — CID 168704842
S-[1-(5-butyl-4-methyl-6-oxo-1H-pyrimidin-2-yl)-5-oxopyrrolidin-3-yl] ethanethioate (PubChem CID 168704842) has the molecular formula C15H21N3O3S and a molecular weight of 323.42 g/mol. Its IUPAC name is S-[1-(5-butyl-4-methyl-6-oxo-1H-pyrimidin-2-yl)-5-oxopyrrolidin-3-yl] ethanethioate.
| Compound Name | S-[1-(5-butyl-4-methyl-6-oxo-1H-pyrimidin-2-yl)-5-oxopyrrolidin-3-yl] ethanethioate |
|---|---|
| PubChem CID | 168704842 |
| Molecular Formula | C15H21N3O3S |
| Molecular Weight | 323.42 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | S-[1-(5-butyl-4-methyl-6-oxo-1H-pyrimidin-2-yl)-5-oxopyrrolidin-3-yl] ethanethioate |
| SMILES | CCCCc1c(C)nc(N2CC(SC(C)=O)CC2=O)[nH]c1=O |
| InChI | InChI=1S/C15H21N3O3S/c1-4-5-6-12-9(2)16-15(17-14(12)21)18-8-11(7-13(18)20)22-10(3)19/h11H,4-8H2,1-3H3,(H,16,17,21) |
| InChIKey | KXDMFJGLDNOAKF-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 83.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.42 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|