C12H16N2O3S — CID 168704765
S-[5-oxo-1-(3-propan-2-yl-1,2-oxazol-5-yl)pyrrolidin-3-yl] ethanethioate (PubChem CID 168704765) has the molecular formula C12H16N2O3S and a molecular weight of 268.34 g/mol. Its IUPAC name is S-[5-oxo-1-(3-propan-2-yl-1,2-oxazol-5-yl)pyrrolidin-3-yl] ethanethioate.
| Compound Name | S-[5-oxo-1-(3-propan-2-yl-1,2-oxazol-5-yl)pyrrolidin-3-yl] ethanethioate |
|---|---|
| PubChem CID | 168704765 |
| Molecular Formula | C12H16N2O3S |
| Molecular Weight | 268.34 g/mol |
| Exact Mass | 268.09 |
| IUPAC Name | S-[5-oxo-1-(3-propan-2-yl-1,2-oxazol-5-yl)pyrrolidin-3-yl] ethanethioate |
| SMILES | CC(=O)SC1CC(=O)N(c2cc(C(C)C)no2)C1 |
| InChI | InChI=1S/C12H16N2O3S/c1-7(2)10-5-12(17-13-10)14-6-9(4-11(14)16)18-8(3)15/h5,7,9H,4,6H2,1-3H3 |
| InChIKey | GJMMVUAMJNYDGT-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 63.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.34 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|