C13H19N3O2S — CID 168704356
S-[1-(5-butan-2-yl-1H-pyrazol-3-yl)-5-oxopyrrolidin-3-yl] ethanethioate (PubChem CID 168704356) has the molecular formula C13H19N3O2S and a molecular weight of 281.38 g/mol. Its IUPAC name is S-[1-(5-butan-2-yl-1H-pyrazol-3-yl)-5-oxopyrrolidin-3-yl] ethanethioate.
| Compound Name | S-[1-(5-butan-2-yl-1H-pyrazol-3-yl)-5-oxopyrrolidin-3-yl] ethanethioate |
|---|---|
| PubChem CID | 168704356 |
| Molecular Formula | C13H19N3O2S |
| Molecular Weight | 281.38 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | S-[1-(5-butan-2-yl-1H-pyrazol-3-yl)-5-oxopyrrolidin-3-yl] ethanethioate |
| SMILES | CCC(C)c1cc(N2CC(SC(C)=O)CC2=O)n[nH]1 |
| InChI | InChI=1S/C13H19N3O2S/c1-4-8(2)11-6-12(15-14-11)16-7-10(5-13(16)18)19-9(3)17/h6,8,10H,4-5,7H2,1-3H3,(H,14,15) |
| InChIKey | UYEPSNDSBZOERP-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.38 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|