C13H13N3O2S2 — CID 168707045
S-[5-oxo-1-(5-thiophen-2-yl-1H-pyrazol-3-yl)pyrrolidin-3-yl] ethanethioate (PubChem CID 168707045) has the molecular formula C13H13N3O2S2 and a molecular weight of 307.40 g/mol. Its IUPAC name is S-[5-oxo-1-(5-thiophen-2-yl-1H-pyrazol-3-yl)pyrrolidin-3-yl] ethanethioate.
| Compound Name | S-[5-oxo-1-(5-thiophen-2-yl-1H-pyrazol-3-yl)pyrrolidin-3-yl] ethanethioate |
|---|---|
| PubChem CID | 168707045 |
| Molecular Formula | C13H13N3O2S2 |
| Molecular Weight | 307.40 g/mol |
| Exact Mass | 307.04 |
| IUPAC Name | S-[5-oxo-1-(5-thiophen-2-yl-1H-pyrazol-3-yl)pyrrolidin-3-yl] ethanethioate |
| SMILES | CC(=O)SC1CC(=O)N(c2cc(-c3cccs3)[nH]n2)C1 |
| InChI | InChI=1S/C13H13N3O2S2/c1-8(17)20-9-5-13(18)16(7-9)12-6-10(14-15-12)11-3-2-4-19-11/h2-4,6,9H,5,7H2,1H3,(H,14,15) |
| InChIKey | VHWPCYCTMJRPKI-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.40 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|