C15H15N3O2S2 — CID 168705746
S-[1-[5-(3-methylphenyl)-1,3,4-thiadiazol-2-yl]-5-oxopyrrolidin-3-yl] ethanethioate (PubChem CID 168705746) has the molecular formula C15H15N3O2S2 and a molecular weight of 333.44 g/mol. Its IUPAC name is S-[1-[5-(3-methylphenyl)-1,3,4-thiadiazol-2-yl]-5-oxopyrrolidin-3-yl] ethanethioate.
| Compound Name | S-[1-[5-(3-methylphenyl)-1,3,4-thiadiazol-2-yl]-5-oxopyrrolidin-3-yl] ethanethioate |
|---|---|
| PubChem CID | 168705746 |
| Molecular Formula | C15H15N3O2S2 |
| Molecular Weight | 333.44 g/mol |
| Exact Mass | 333.06 |
| IUPAC Name | S-[1-[5-(3-methylphenyl)-1,3,4-thiadiazol-2-yl]-5-oxopyrrolidin-3-yl] ethanethioate |
| SMILES | CC(=O)SC1CC(=O)N(c2nnc(-c3cccc(C)c3)s2)C1 |
| InChI | InChI=1S/C15H15N3O2S2/c1-9-4-3-5-11(6-9)14-16-17-15(22-14)18-8-12(7-13(18)20)21-10(2)19/h3-6,12H,7-8H2,1-2H3 |
| InChIKey | GVRZHADSPHMTJP-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 63.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.44 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|