C13H12ClNO4S — CID 168706756
4-(4-acetylsulfanyl-2-oxopyrrolidin-1-yl)-3-chlorobenzoic acid (PubChem CID 168706756) has the molecular formula C13H12ClNO4S and a molecular weight of 313.76 g/mol. Its IUPAC name is 4-(4-acetylsulfanyl-2-oxopyrrolidin-1-yl)-3-chlorobenzoic acid.
| Compound Name | 4-(4-acetylsulfanyl-2-oxopyrrolidin-1-yl)-3-chlorobenzoic acid |
|---|---|
| PubChem CID | 168706756 |
| Molecular Formula | C13H12ClNO4S |
| Molecular Weight | 313.76 g/mol |
| Exact Mass | 313.02 |
| IUPAC Name | 4-(4-acetylsulfanyl-2-oxopyrrolidin-1-yl)-3-chlorobenzoic acid |
| SMILES | CC(=O)SC1CC(=O)N(c2ccc(C(=O)O)cc2Cl)C1 |
| InChI | InChI=1S/C13H12ClNO4S/c1-7(16)20-9-5-12(17)15(6-9)11-3-2-8(13(18)19)4-10(11)14/h2-4,9H,5-6H2,1H3,(H,18,19) |
| InChIKey | CEPSVQFOJXUJEY-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.76 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|