C13H11F2NO4S — CID 168707260
S-[1-(2,2-difluoro-1,3-benzodioxol-4-yl)-5-oxopyrrolidin-3-yl] ethanethioate (PubChem CID 168707260) has the molecular formula C13H11F2NO4S and a molecular weight of 315.30 g/mol. Its IUPAC name is S-[1-(2,2-difluoro-1,3-benzodioxol-4-yl)-5-oxopyrrolidin-3-yl] ethanethioate.
| Compound Name | S-[1-(2,2-difluoro-1,3-benzodioxol-4-yl)-5-oxopyrrolidin-3-yl] ethanethioate |
|---|---|
| PubChem CID | 168707260 |
| Molecular Formula | C13H11F2NO4S |
| Molecular Weight | 315.30 g/mol |
| Exact Mass | 315.04 |
| IUPAC Name | S-[1-(2,2-difluoro-1,3-benzodioxol-4-yl)-5-oxopyrrolidin-3-yl] ethanethioate |
| SMILES | CC(=O)SC1CC(=O)N(c2cccc3c2OC(F)(F)O3)C1 |
| InChI | InChI=1S/C13H11F2NO4S/c1-7(17)21-8-5-11(18)16(6-8)9-3-2-4-10-12(9)20-13(14,15)19-10/h2-4,8H,5-6H2,1H3 |
| InChIKey | WINHRROUKYLZIE-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.30 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|