C12H11F2NO3S — CID 168672184
1-(2,2-difluoro-1,3-benzodioxol-4-yl)-4-(sulfanylmethyl)pyrrolidin-2-one (PubChem CID 168672184) has the molecular formula C12H11F2NO3S and a molecular weight of 287.29 g/mol. Its IUPAC name is 1-(2,2-difluoro-1,3-benzodioxol-4-yl)-4-(sulfanylmethyl)pyrrolidin-2-one.
| Compound Name | 1-(2,2-difluoro-1,3-benzodioxol-4-yl)-4-(sulfanylmethyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 168672184 |
| Molecular Formula | C12H11F2NO3S |
| Molecular Weight | 287.29 g/mol |
| Exact Mass | 287.04 |
| IUPAC Name | 1-(2,2-difluoro-1,3-benzodioxol-4-yl)-4-(sulfanylmethyl)pyrrolidin-2-one |
| SMILES | O=C1CC(CS)CN1c1cccc2c1OC(F)(F)O2 |
| InChI | InChI=1S/C12H11F2NO3S/c13-12(14)17-9-3-1-2-8(11(9)18-12)15-5-7(6-19)4-10(15)16/h1-3,7,19H,4-6H2 |
| InChIKey | HEPIJOVKUZEDGQ-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 38.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.29 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|