C13H17NOS — CID 168709083
1-[(2,3-dimethylphenyl)methyl]-4-sulfanylpyrrolidin-2-one (PubChem CID 168709083) has the molecular formula C13H17NOS and a molecular weight of 235.35 g/mol. Its IUPAC name is 1-[(2,3-dimethylphenyl)methyl]-4-sulfanylpyrrolidin-2-one.
| Compound Name | 1-[(2,3-dimethylphenyl)methyl]-4-sulfanylpyrrolidin-2-one |
|---|---|
| PubChem CID | 168709083 |
| Molecular Formula | C13H17NOS |
| Molecular Weight | 235.35 g/mol |
| Exact Mass | 235.10 |
| IUPAC Name | 1-[(2,3-dimethylphenyl)methyl]-4-sulfanylpyrrolidin-2-one |
| SMILES | Cc1cccc(CN2CC(S)CC2=O)c1C |
| InChI | InChI=1S/C13H17NOS/c1-9-4-3-5-11(10(9)2)7-14-8-12(16)6-13(14)15/h3-5,12,16H,6-8H2,1-2H3 |
| InChIKey | KGQHTSCHLVHETR-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 20.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.35 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|