C13H16ClNO — CID 168688320
4-chloro-1-[(2,6-dimethylphenyl)methyl]pyrrolidin-2-one (PubChem CID 168688320) has the molecular formula C13H16ClNO and a molecular weight of 237.73 g/mol. Its IUPAC name is 4-chloro-1-[(2,6-dimethylphenyl)methyl]pyrrolidin-2-one.
| Compound Name | 4-chloro-1-[(2,6-dimethylphenyl)methyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 168688320 |
| Molecular Formula | C13H16ClNO |
| Molecular Weight | 237.73 g/mol |
| Exact Mass | 237.09 |
| IUPAC Name | 4-chloro-1-[(2,6-dimethylphenyl)methyl]pyrrolidin-2-one |
| SMILES | Cc1cccc(C)c1CN1CC(Cl)CC1=O |
| InChI | InChI=1S/C13H16ClNO/c1-9-4-3-5-10(2)12(9)8-15-7-11(14)6-13(15)16/h3-5,11H,6-8H2,1-2H3 |
| InChIKey | FCZNHHHDKUMCGE-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.73 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|