C8H9ClN2O2 — CID 168688847
4-chloro-1-(1,2-oxazol-3-ylmethyl)pyrrolidin-2-one (PubChem CID 168688847) has the molecular formula C8H9ClN2O2 and a molecular weight of 200.62 g/mol. Its IUPAC name is 4-chloro-1-(1,2-oxazol-3-ylmethyl)pyrrolidin-2-one.
| Compound Name | 4-chloro-1-(1,2-oxazol-3-ylmethyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 168688847 |
| Molecular Formula | C8H9ClN2O2 |
| Molecular Weight | 200.62 g/mol |
| Exact Mass | 200.04 |
| IUPAC Name | 4-chloro-1-(1,2-oxazol-3-ylmethyl)pyrrolidin-2-one |
| SMILES | O=C1CC(Cl)CN1Cc1ccon1 |
| InChI | InChI=1S/C8H9ClN2O2/c9-6-3-8(12)11(4-6)5-7-1-2-13-10-7/h1-2,6H,3-5H2 |
| InChIKey | FXOPKEKHLYIULX-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.62 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|