C10H13ClN2OS — CID 168688221
4-chloro-1-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]pyrrolidin-2-one (PubChem CID 168688221) has the molecular formula C10H13ClN2OS and a molecular weight of 244.75 g/mol. Its IUPAC name is 4-chloro-1-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]pyrrolidin-2-one.
| Compound Name | 4-chloro-1-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 168688221 |
| Molecular Formula | C10H13ClN2OS |
| Molecular Weight | 244.75 g/mol |
| Exact Mass | 244.04 |
| IUPAC Name | 4-chloro-1-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]pyrrolidin-2-one |
| SMILES | Cc1nc(C)c(CN2CC(Cl)CC2=O)s1 |
| InChI | InChI=1S/C10H13ClN2OS/c1-6-9(15-7(2)12-6)5-13-4-8(11)3-10(13)14/h8H,3-5H2,1-2H3 |
| InChIKey | IYMREUPQHXAFKP-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.75 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|