C14H18ClNO4 — CID 168687883
4-chloro-1-[(3,4,5-trimethoxyphenyl)methyl]pyrrolidin-2-one (PubChem CID 168687883) has the molecular formula C14H18ClNO4 and a molecular weight of 299.75 g/mol. Its IUPAC name is 4-chloro-1-[(3,4,5-trimethoxyphenyl)methyl]pyrrolidin-2-one.
| Compound Name | 4-chloro-1-[(3,4,5-trimethoxyphenyl)methyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 168687883 |
| Molecular Formula | C14H18ClNO4 |
| Molecular Weight | 299.75 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | 4-chloro-1-[(3,4,5-trimethoxyphenyl)methyl]pyrrolidin-2-one |
| SMILES | COc1cc(CN2CC(Cl)CC2=O)cc(OC)c1OC |
| InChI | InChI=1S/C14H18ClNO4/c1-18-11-4-9(5-12(19-2)14(11)20-3)7-16-8-10(15)6-13(16)17/h4-5,10H,6-8H2,1-3H3 |
| InChIKey | ZNYNOJXOOPJWAF-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.75 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|