C23H31N3O8 — CID 20519809
4-nitro-1,2-bis[(3,4,5-trimethoxyphenyl)methyl]pyrazolidine (PubChem CID 20519809) has the molecular formula C23H31N3O8 and a molecular weight of 477.51 g/mol. Its IUPAC name is 4-nitro-1,2-bis[(3,4,5-trimethoxyphenyl)methyl]pyrazolidine.
| Compound Name | 4-nitro-1,2-bis[(3,4,5-trimethoxyphenyl)methyl]pyrazolidine |
|---|---|
| PubChem CID | 20519809 |
| Molecular Formula | C23H31N3O8 |
| Molecular Weight | 477.51 g/mol |
| Exact Mass | 477.21 |
| IUPAC Name | 4-nitro-1,2-bis[(3,4,5-trimethoxyphenyl)methyl]pyrazolidine |
| SMILES | COc1cc(CN2CC([N+](=O)[O-])CN2Cc2cc(OC)c(OC)c(OC)c2)cc(OC)c1OC |
| InChI | InChI=1S/C23H31N3O8/c1-29-18-7-15(8-19(30-2)22(18)33-5)11-24-13-17(26(27)28)14-25(24)12-16-9-20(31-3)23(34-6)21(10-16)32-4/h7-10,17H,11-14H2,1-6H3 |
| InChIKey | RGJZJLFWYQZXEW-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 105.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.51 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|