C12H12ClN3O3S — CID 168711992
1-(2-methylindazol-5-yl)-5-oxopyrrolidine-3-sulfonyl chloride (PubChem CID 168711992) has the molecular formula C12H12ClN3O3S and a molecular weight of 313.77 g/mol. Its IUPAC name is 1-(2-methylindazol-5-yl)-5-oxopyrrolidine-3-sulfonyl chloride.
| Compound Name | 1-(2-methylindazol-5-yl)-5-oxopyrrolidine-3-sulfonyl chloride |
|---|---|
| PubChem CID | 168711992 |
| Molecular Formula | C12H12ClN3O3S |
| Molecular Weight | 313.77 g/mol |
| Exact Mass | 313.03 |
| IUPAC Name | 1-(2-methylindazol-5-yl)-5-oxopyrrolidine-3-sulfonyl chloride |
| SMILES | Cn1cc2cc(N3CC(S(=O)(=O)Cl)CC3=O)ccc2n1 |
| InChI | InChI=1S/C12H12ClN3O3S/c1-15-6-8-4-9(2-3-11(8)14-15)16-7-10(5-12(16)17)20(13,18)19/h2-4,6,10H,5,7H2,1H3 |
| InChIKey | RJYNDJOUNIEKCU-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 72.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.77 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |