C14H15N3O2S — CID 168705873
S-[1-(2-methylindazol-5-yl)-5-oxopyrrolidin-3-yl] ethanethioate (PubChem CID 168705873) has the molecular formula C14H15N3O2S and a molecular weight of 289.36 g/mol. Its IUPAC name is S-[1-(2-methylindazol-5-yl)-5-oxopyrrolidin-3-yl] ethanethioate.
| Compound Name | S-[1-(2-methylindazol-5-yl)-5-oxopyrrolidin-3-yl] ethanethioate |
|---|---|
| PubChem CID | 168705873 |
| Molecular Formula | C14H15N3O2S |
| Molecular Weight | 289.36 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | S-[1-(2-methylindazol-5-yl)-5-oxopyrrolidin-3-yl] ethanethioate |
| SMILES | CC(=O)SC1CC(=O)N(c2ccc3nn(C)cc3c2)C1 |
| InChI | InChI=1S/C14H15N3O2S/c1-9(18)20-12-6-14(19)17(8-12)11-3-4-13-10(5-11)7-16(2)15-13/h3-5,7,12H,6,8H2,1-2H3 |
| InChIKey | RWHAKMGLPQALPE-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.36 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|