C11H9ClF3NO3S — CID 168712180
5-oxo-1-[(3,4,5-trifluorophenyl)methyl]pyrrolidine-3-sulfonyl chloride (PubChem CID 168712180) has the molecular formula C11H9ClF3NO3S and a molecular weight of 327.71 g/mol. Its IUPAC name is 5-oxo-1-[(3,4,5-trifluorophenyl)methyl]pyrrolidine-3-sulfonyl chloride.
| Compound Name | 5-oxo-1-[(3,4,5-trifluorophenyl)methyl]pyrrolidine-3-sulfonyl chloride |
|---|---|
| PubChem CID | 168712180 |
| Molecular Formula | C11H9ClF3NO3S |
| Molecular Weight | 327.71 g/mol |
| Exact Mass | 326.99 |
| IUPAC Name | 5-oxo-1-[(3,4,5-trifluorophenyl)methyl]pyrrolidine-3-sulfonyl chloride |
| SMILES | O=C1CC(S(=O)(=O)Cl)CN1Cc1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C11H9ClF3NO3S/c12-20(18,19)7-3-10(17)16(5-7)4-6-1-8(13)11(15)9(14)2-6/h1-2,7H,3-5H2 |
| InChIKey | CAQBMGFELXOVHO-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.71 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|