C9H7BrClN3O5S — CID 168712669
1-(3-bromo-5-nitro-2-pyridinyl)-5-oxopyrrolidine-3-sulfonyl chloride (PubChem CID 168712669) has the molecular formula C9H7BrClN3O5S and a molecular weight of 384.60 g/mol. Its IUPAC name is 1-(3-bromo-5-nitro-2-pyridinyl)-5-oxopyrrolidine-3-sulfonyl chloride.
| Compound Name | 1-(3-bromo-5-nitro-2-pyridinyl)-5-oxopyrrolidine-3-sulfonyl chloride |
|---|---|
| PubChem CID | 168712669 |
| Molecular Formula | C9H7BrClN3O5S |
| Molecular Weight | 384.60 g/mol |
| Exact Mass | 382.90 |
| IUPAC Name | 1-(3-bromo-5-nitro-2-pyridinyl)-5-oxopyrrolidine-3-sulfonyl chloride |
| SMILES | O=C1CC(S(=O)(=O)Cl)CN1c1ncc([N+](=O)[O-])cc1Br |
| InChI | InChI=1S/C9H7BrClN3O5S/c10-7-1-5(14(16)17)3-12-9(7)13-4-6(2-8(13)15)20(11,18)19/h1,3,6H,2,4H2 |
| InChIKey | AXFPJUHFEQSNJW-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 110.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.60 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|