C10H17FN2O3S — CID 168713053
1-(2-aminocyclohexyl)-5-oxopyrrolidine-3-sulfonyl fluoride (PubChem CID 168713053) has the molecular formula C10H17FN2O3S and a molecular weight of 264.32 g/mol. Its IUPAC name is 1-(2-aminocyclohexyl)-5-oxopyrrolidine-3-sulfonyl fluoride.
| Compound Name | 1-(2-aminocyclohexyl)-5-oxopyrrolidine-3-sulfonyl fluoride |
|---|---|
| PubChem CID | 168713053 |
| Molecular Formula | C10H17FN2O3S |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | 1-(2-aminocyclohexyl)-5-oxopyrrolidine-3-sulfonyl fluoride |
| SMILES | NC1CCCCC1N1CC(S(=O)(=O)F)CC1=O |
| InChI | InChI=1S/C10H17FN2O3S/c11-17(15,16)7-5-10(14)13(6-7)9-4-2-1-3-8(9)12/h7-9H,1-6,12H2 |
| InChIKey | LZRCARBEXVMCIL-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |