C11H19FN2O3S — CID 168674953
[1-(azepan-3-yl)-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride (PubChem CID 168674953) has the molecular formula C11H19FN2O3S and a molecular weight of 278.35 g/mol. Its IUPAC name is [1-(azepan-3-yl)-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride.
| Compound Name | [1-(azepan-3-yl)-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride |
|---|---|
| PubChem CID | 168674953 |
| Molecular Formula | C11H19FN2O3S |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | [1-(azepan-3-yl)-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride |
| SMILES | O=C1CC(CS(=O)(=O)F)CN1C1CCCCNC1 |
| InChI | InChI=1S/C11H19FN2O3S/c12-18(16,17)8-9-5-11(15)14(7-9)10-3-1-2-4-13-6-10/h9-10,13H,1-8H2 |
| InChIKey | PYTJWAIYIBPKOT-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |