C10H19FN2O3S — CID 168674792
[1-(3-aminopentyl)-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride (PubChem CID 168674792) has the molecular formula C10H19FN2O3S and a molecular weight of 266.34 g/mol. Its IUPAC name is [1-(3-aminopentyl)-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride.
| Compound Name | [1-(3-aminopentyl)-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride |
|---|---|
| PubChem CID | 168674792 |
| Molecular Formula | C10H19FN2O3S |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | [1-(3-aminopentyl)-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride |
| SMILES | CCC(N)CCN1CC(CS(=O)(=O)F)CC1=O |
| InChI | InChI=1S/C10H19FN2O3S/c1-2-9(12)3-4-13-6-8(5-10(13)14)7-17(11,15)16/h8-9H,2-7,12H2,1H3 |
| InChIKey | WMJAQXZHLYZYBJ-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |