C8H15FN2O3S — CID 168674724
[1-(2-aminopropyl)-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride (PubChem CID 168674724) has the molecular formula C8H15FN2O3S and a molecular weight of 238.28 g/mol. Its IUPAC name is [1-(2-aminopropyl)-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride.
| Compound Name | [1-(2-aminopropyl)-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride |
|---|---|
| PubChem CID | 168674724 |
| Molecular Formula | C8H15FN2O3S |
| Molecular Weight | 238.28 g/mol |
| Exact Mass | 238.08 |
| IUPAC Name | [1-(2-aminopropyl)-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride |
| SMILES | CC(N)CN1CC(CS(=O)(=O)F)CC1=O |
| InChI | InChI=1S/C8H15FN2O3S/c1-6(10)3-11-4-7(2-8(11)12)5-15(9,13)14/h6-7H,2-5,10H2,1H3 |
| InChIKey | PGMJEBPXMZDSDO-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.28 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |