C10H16FNO5S — CID 168713105
3-(4-fluorosulfonyl-2-oxopyrrolidin-1-yl)-4-methylpentanoic acid (PubChem CID 168713105) has the molecular formula C10H16FNO5S and a molecular weight of 281.31 g/mol. Its IUPAC name is 3-(4-fluorosulfonyl-2-oxopyrrolidin-1-yl)-4-methylpentanoic acid.
| Compound Name | 3-(4-fluorosulfonyl-2-oxopyrrolidin-1-yl)-4-methylpentanoic acid |
|---|---|
| PubChem CID | 168713105 |
| Molecular Formula | C10H16FNO5S |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.07 |
| IUPAC Name | 3-(4-fluorosulfonyl-2-oxopyrrolidin-1-yl)-4-methylpentanoic acid |
| SMILES | CC(C)C(CC(=O)O)N1CC(S(=O)(=O)F)CC1=O |
| InChI | InChI=1S/C10H16FNO5S/c1-6(2)8(4-10(14)15)12-5-7(3-9(12)13)18(11,16)17/h6-8H,3-5H2,1-2H3,(H,14,15) |
| InChIKey | BKHBNTVBYPENAG-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |