C9H17FN2O3S — CID 168713720
1-[3-(ethylamino)propyl]-5-oxopyrrolidine-3-sulfonyl fluoride (PubChem CID 168713720) has the molecular formula C9H17FN2O3S and a molecular weight of 252.31 g/mol. Its IUPAC name is 1-[3-(ethylamino)propyl]-5-oxopyrrolidine-3-sulfonyl fluoride.
| Compound Name | 1-[3-(ethylamino)propyl]-5-oxopyrrolidine-3-sulfonyl fluoride |
|---|---|
| PubChem CID | 168713720 |
| Molecular Formula | C9H17FN2O3S |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.09 |
| IUPAC Name | 1-[3-(ethylamino)propyl]-5-oxopyrrolidine-3-sulfonyl fluoride |
| SMILES | CCNCCCN1CC(S(=O)(=O)F)CC1=O |
| InChI | InChI=1S/C9H17FN2O3S/c1-2-11-4-3-5-12-7-8(6-9(12)13)16(10,14)15/h8,11H,2-7H2,1H3 |
| InChIKey | GPFVAIQEYJYNJQ-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|