C9H12FN3O3S — CID 168714698
1-[(1-methylimidazol-2-yl)methyl]-5-oxopyrrolidine-3-sulfonyl fluoride (PubChem CID 168714698) has the molecular formula C9H12FN3O3S and a molecular weight of 261.28 g/mol. Its IUPAC name is 1-[(1-methylimidazol-2-yl)methyl]-5-oxopyrrolidine-3-sulfonyl fluoride.
| Compound Name | 1-[(1-methylimidazol-2-yl)methyl]-5-oxopyrrolidine-3-sulfonyl fluoride |
|---|---|
| PubChem CID | 168714698 |
| Molecular Formula | C9H12FN3O3S |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.06 |
| IUPAC Name | 1-[(1-methylimidazol-2-yl)methyl]-5-oxopyrrolidine-3-sulfonyl fluoride |
| SMILES | Cn1ccnc1CN1CC(S(=O)(=O)F)CC1=O |
| InChI | InChI=1S/C9H12FN3O3S/c1-12-3-2-11-8(12)6-13-5-7(4-9(13)14)17(10,15)16/h2-3,7H,4-6H2,1H3 |
| InChIKey | HACDOORRNUNQLW-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 72.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |