C9H12FN3O3S — CID 168714948
1-[2-(1H-imidazol-2-yl)ethyl]-5-oxopyrrolidine-3-sulfonyl fluoride (PubChem CID 168714948) has the molecular formula C9H12FN3O3S and a molecular weight of 261.28 g/mol. Its IUPAC name is 1-[2-(1H-imidazol-2-yl)ethyl]-5-oxopyrrolidine-3-sulfonyl fluoride.
| Compound Name | 1-[2-(1H-imidazol-2-yl)ethyl]-5-oxopyrrolidine-3-sulfonyl fluoride |
|---|---|
| PubChem CID | 168714948 |
| Molecular Formula | C9H12FN3O3S |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.06 |
| IUPAC Name | 1-[2-(1H-imidazol-2-yl)ethyl]-5-oxopyrrolidine-3-sulfonyl fluoride |
| SMILES | O=C1CC(S(=O)(=O)F)CN1CCc1ncc[nH]1 |
| InChI | InChI=1S/C9H12FN3O3S/c10-17(15,16)7-5-9(14)13(6-7)4-1-8-11-2-3-12-8/h2-3,7H,1,4-6H2,(H,11,12) |
| InChIKey | IGLRUWPNNMLZLE-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 83.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |