C11H10BrF2NO3S — CID 168714969
1-[(2-bromo-5-fluorophenyl)methyl]-5-oxopyrrolidine-3-sulfonyl fluoride (PubChem CID 168714969) has the molecular formula C11H10BrF2NO3S and a molecular weight of 354.17 g/mol. Its IUPAC name is 1-[(2-bromo-5-fluorophenyl)methyl]-5-oxopyrrolidine-3-sulfonyl fluoride.
| Compound Name | 1-[(2-bromo-5-fluorophenyl)methyl]-5-oxopyrrolidine-3-sulfonyl fluoride |
|---|---|
| PubChem CID | 168714969 |
| Molecular Formula | C11H10BrF2NO3S |
| Molecular Weight | 354.17 g/mol |
| Exact Mass | 352.95 |
| IUPAC Name | 1-[(2-bromo-5-fluorophenyl)methyl]-5-oxopyrrolidine-3-sulfonyl fluoride |
| SMILES | O=C1CC(S(=O)(=O)F)CN1Cc1cc(F)ccc1Br |
| InChI | InChI=1S/C11H10BrF2NO3S/c12-10-2-1-8(13)3-7(10)5-15-6-9(4-11(15)16)19(14,17)18/h1-3,9H,4-6H2 |
| InChIKey | PTYHCCRDFKJHLS-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.17 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |