C10H8FN3O7S — CID 168715280
1-(2,6-dinitrophenyl)-5-oxopyrrolidine-3-sulfonyl fluoride (PubChem CID 168715280) has the molecular formula C10H8FN3O7S and a molecular weight of 333.25 g/mol. Its IUPAC name is 1-(2,6-dinitrophenyl)-5-oxopyrrolidine-3-sulfonyl fluoride.
| Compound Name | 1-(2,6-dinitrophenyl)-5-oxopyrrolidine-3-sulfonyl fluoride |
|---|---|
| PubChem CID | 168715280 |
| Molecular Formula | C10H8FN3O7S |
| Molecular Weight | 333.25 g/mol |
| Exact Mass | 333.01 |
| IUPAC Name | 1-(2,6-dinitrophenyl)-5-oxopyrrolidine-3-sulfonyl fluoride |
| SMILES | O=C1CC(S(=O)(=O)F)CN1c1c([N+](=O)[O-])cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H8FN3O7S/c11-22(20,21)6-4-9(15)12(5-6)10-7(13(16)17)2-1-3-8(10)14(18)19/h1-3,6H,4-5H2 |
| InChIKey | NOSIMRWXVZTDDN-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 140.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.25 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|