C9H10ClN3O4S — CID 168718581
1-(5-chloro-3-hydroxy-2-pyridinyl)-5-oxopyrrolidine-3-sulfonamide (PubChem CID 168718581) has the molecular formula C9H10ClN3O4S and a molecular weight of 291.72 g/mol. Its IUPAC name is 1-(5-chloro-3-hydroxy-2-pyridinyl)-5-oxopyrrolidine-3-sulfonamide.
| Compound Name | 1-(5-chloro-3-hydroxy-2-pyridinyl)-5-oxopyrrolidine-3-sulfonamide |
|---|---|
| PubChem CID | 168718581 |
| Molecular Formula | C9H10ClN3O4S |
| Molecular Weight | 291.72 g/mol |
| Exact Mass | 291.01 |
| IUPAC Name | 1-(5-chloro-3-hydroxy-2-pyridinyl)-5-oxopyrrolidine-3-sulfonamide |
| SMILES | NS(=O)(=O)C1CC(=O)N(c2ncc(Cl)cc2O)C1 |
| InChI | InChI=1S/C9H10ClN3O4S/c10-5-1-7(14)9(12-3-5)13-4-6(2-8(13)15)18(11,16)17/h1,3,6,14H,2,4H2,(H2,11,16,17) |
| InChIKey | UINMKOPLRHKMQS-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 113.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.72 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |