C8H8ClN5O5S — CID 168719060
1-(2-chloro-5-nitropyrimidin-4-yl)-5-oxopyrrolidine-3-sulfonamide (PubChem CID 168719060) has the molecular formula C8H8ClN5O5S and a molecular weight of 321.70 g/mol. Its IUPAC name is 1-(2-chloro-5-nitropyrimidin-4-yl)-5-oxopyrrolidine-3-sulfonamide.
| Compound Name | 1-(2-chloro-5-nitropyrimidin-4-yl)-5-oxopyrrolidine-3-sulfonamide |
|---|---|
| PubChem CID | 168719060 |
| Molecular Formula | C8H8ClN5O5S |
| Molecular Weight | 321.70 g/mol |
| Exact Mass | 320.99 |
| IUPAC Name | 1-(2-chloro-5-nitropyrimidin-4-yl)-5-oxopyrrolidine-3-sulfonamide |
| SMILES | NS(=O)(=O)C1CC(=O)N(c2nc(Cl)ncc2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C8H8ClN5O5S/c9-8-11-2-5(14(16)17)7(12-8)13-3-4(1-6(13)15)20(10,18)19/h2,4H,1,3H2,(H2,10,18,19) |
| InChIKey | JIYMGDJYVBTBHD-UHFFFAOYSA-N |
| XLogP | -0.57 |
| TPSA | 149.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.70 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|