C16H23F2NO3 — CID 168720261
2,2-difluoro-4-(5-hydroxy-4-methylcyclohex-3-en-1-yl)-1-morpholin-4-ylpent-4-en-1-one (PubChem CID 168720261) has the molecular formula C16H23F2NO3 and a molecular weight of 315.36 g/mol. Its IUPAC name is 2,2-difluoro-4-(5-hydroxy-4-methylcyclohex-3-en-1-yl)-1-morpholin-4-ylpent-4-en-1-one.
| Compound Name | 2,2-difluoro-4-(5-hydroxy-4-methylcyclohex-3-en-1-yl)-1-morpholin-4-ylpent-4-en-1-one |
|---|---|
| PubChem CID | 168720261 |
| Molecular Formula | C16H23F2NO3 |
| Molecular Weight | 315.36 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | 2,2-difluoro-4-(5-hydroxy-4-methylcyclohex-3-en-1-yl)-1-morpholin-4-ylpent-4-en-1-one |
| SMILES | C=C(CC(F)(F)C(=O)N1CCOCC1)C1CC=C(C)C(O)C1 |
| InChI | InChI=1S/C16H23F2NO3/c1-11-3-4-13(9-14(11)20)12(2)10-16(17,18)15(21)19-5-7-22-8-6-19/h3,13-14,20H,2,4-10H2,1H3 |
| InChIKey | KMQLUXXGDGUGBX-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.36 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|