C16H25F2NO3 — CID 168720258
2,2-difluoro-4-[(1R,2S,4S)-2-hydroxy-4-methylcyclohexyl]-1-morpholin-4-ylpent-4-en-1-one (PubChem CID 168720258) has the molecular formula C16H25F2NO3 and a molecular weight of 317.38 g/mol. Its IUPAC name is 2,2-difluoro-4-[(1R,2S,4S)-2-hydroxy-4-methylcyclohexyl]-1-morpholin-4-ylpent-4-en-1-one.
| Compound Name | 2,2-difluoro-4-[(1R,2S,4S)-2-hydroxy-4-methylcyclohexyl]-1-morpholin-4-ylpent-4-en-1-one |
|---|---|
| PubChem CID | 168720258 |
| Molecular Formula | C16H25F2NO3 |
| Molecular Weight | 317.38 g/mol |
| Exact Mass | 317.18 |
| IUPAC Name | 2,2-difluoro-4-[(1R,2S,4S)-2-hydroxy-4-methylcyclohexyl]-1-morpholin-4-ylpent-4-en-1-one |
| SMILES | C=C(CC(F)(F)C(=O)N1CCOCC1)[C@H]1CC[C@H](C)C[C@@H]1O |
| InChI | InChI=1S/C16H25F2NO3/c1-11-3-4-13(14(20)9-11)12(2)10-16(17,18)15(21)19-5-7-22-8-6-19/h11,13-14,20H,2-10H2,1H3/t11-,13+,14-/m0/s1 |
| InChIKey | VSJCGJPYJMEAHU-YUTCNCBUSA-N |
| XLogP | 2.22 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.38 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|