C19H22F2O4S — CID 168720281
(S)-2,2-difluoro-4-(4-methyl-5-oxocyclohex-3-en-1-yl)pent-4-en-1-yl 4-methylbenzenesulfonate (PubChem CID 168720281) has the molecular formula C19H22F2O4S and a molecular weight of 384.40 g/mol. Its IUPAC name is [2,2-difluoro-4-[(1S)-4-methyl-5-oxocyclohex-3-en-1-yl]pent-4-enyl] 4-methylbenzenesulfonate.
| Compound Name | (S)-2,2-difluoro-4-(4-methyl-5-oxocyclohex-3-en-1-yl)pent-4-en-1-yl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 168720281 |
| Molecular Formula | C19H22F2O4S |
| Molecular Weight | 384.40 g/mol |
| Exact Mass | 384.12 |
| IUPAC Name | [2,2-difluoro-4-[(1S)-4-methyl-5-oxocyclohex-3-en-1-yl]pent-4-enyl] 4-methylbenzenesulfonate |
| SMILES | CC1=CC[C@@H](CC1=O)C(=C)CC(COS(=O)(=O)C2=CC=C(C=C2)C)(F)F |
| InChI | InChI=1S/C19H22F2O4S/c1-13-4-8-17(9-5-13)26(23,24)25-12-19(20,21)11-15(3)16-7-6-14(2)18(22)10-16/h4-6,8-9,16H,3,7,10-12H2,1-2H3/t16-/m0/s1 |
| InChIKey | OJLUFAPMYXDPCL-INIZCTEOSA-N |
| XLogP | 4.30 |
| TPSA | 68.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | 668 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.40 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|