C29H38N4O4S — CID 168727053
(2R,4S)-N-[(1R)-2,2-dimethyl-1-[4-(4-methyl-1,3-thiazol-5-yl)phenyl]propyl]-4-hydroxy-1-[3-methyl-2-(3-methyl-1,2-oxazol-5-yl)butanoyl]pyrrolidine-2-carboxamide (PubChem CID 168727053) has the molecular formula C29H38N4O4S and a molecular weight of 538.71 g/mol. Its IUPAC name is (2R,4S)-N-[(1R)-2,2-dimethyl-1-[4-(4-methyl-1,3-thiazol-5-yl)phenyl]propyl]-4-hydroxy-1-[3-methyl-2-(3-methyl-1,2-oxazol-5-yl)butanoyl]pyrrolidine-2-carboxamide.
| Compound Name | (2R,4S)-N-[(1R)-2,2-dimethyl-1-[4-(4-methyl-1,3-thiazol-5-yl)phenyl]propyl]-4-hydroxy-1-[3-methyl-2-(3-methyl-1,2-oxazol-5-yl)butanoyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 168727053 |
| Molecular Formula | C29H38N4O4S |
| Molecular Weight | 538.71 g/mol |
| Exact Mass | 538.26 |
| IUPAC Name | (2R,4S)-N-[(1R)-2,2-dimethyl-1-[4-(4-methyl-1,3-thiazol-5-yl)phenyl]propyl]-4-hydroxy-1-[3-methyl-2-(3-methyl-1,2-oxazol-5-yl)butanoyl]pyrrolidine-2-carboxamide |
| SMILES | Cc1cc(C(C(=O)N2C[C@@H](O)C[C@@H]2C(=O)N[C@@H](c2ccc(-c3scnc3C)cc2)C(C)(C)C)C(C)C)on1 |
| InChI | InChI=1S/C29H38N4O4S/c1-16(2)24(23-12-17(3)32-37-23)28(36)33-14-21(34)13-22(33)27(35)31-26(29(5,6)7)20-10-8-19(9-11-20)25-18(4)30-15-38-25/h8-12,15-16,21-22,24,26,34H,13-14H2,1-7H3,(H,31,35)/t21-,22+,24?,26-/m0/s1 |
| InChIKey | UPUGPJADLXTTMV-ZWFOOVPJSA-N |
| XLogP | 5.02 |
| TPSA | 108.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.71 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |