C26H30N4O7S — CID 177069165
[5-[(2R)-1-[(2S,4R)-4-hydroxy-2-[[(1S)-1-[4-(4-methyl-1,3-thiazol-5-yl)phenyl]ethyl]carbamoyl]pyrrolidin-1-yl]-3-methyl-1-oxobutan-2-yl]-1,2-oxazol-3-yl]oxy formate (PubChem CID 177069165) has the molecular formula C26H30N4O7S and a molecular weight of 542.61 g/mol. Its IUPAC name is [5-[(2R)-1-[(2S,4R)-4-hydroxy-2-[[(1S)-1-[4-(4-methyl-1,3-thiazol-5-yl)phenyl]ethyl]carbamoyl]pyrrolidin-1-yl]-3-methyl-1-oxobutan-2-yl]-1,2-oxazol-3-yl]oxy formate.
| Compound Name | [5-[(2R)-1-[(2S,4R)-4-hydroxy-2-[[(1S)-1-[4-(4-methyl-1,3-thiazol-5-yl)phenyl]ethyl]carbamoyl]pyrrolidin-1-yl]-3-methyl-1-oxobutan-2-yl]-1,2-oxazol-3-yl]oxy formate |
|---|---|
| PubChem CID | 177069165 |
| Molecular Formula | C26H30N4O7S |
| Molecular Weight | 542.61 g/mol |
| Exact Mass | 542.18 |
| IUPAC Name | [5-[(2R)-1-[(2S,4R)-4-hydroxy-2-[[(1S)-1-[4-(4-methyl-1,3-thiazol-5-yl)phenyl]ethyl]carbamoyl]pyrrolidin-1-yl]-3-methyl-1-oxobutan-2-yl]-1,2-oxazol-3-yl]oxy formate |
| SMILES | Cc1ncsc1-c1ccc([C@H](C)NC(=O)[C@@H]2C[C@@H](O)CN2C(=O)[C@@H](c2cc(OOC=O)no2)C(C)C)cc1 |
| InChI | InChI=1S/C26H30N4O7S/c1-14(2)23(21-10-22(29-36-21)37-35-13-31)26(34)30-11-19(32)9-20(30)25(33)28-15(3)17-5-7-18(8-6-17)24-16(4)27-12-38-24/h5-8,10,12-15,19-20,23,32H,9,11H2,1-4H3,(H,28,33)/t15-,19+,20-,23+/m0/s1 |
| InChIKey | PQNNQEABRHIMNK-IXHQSITISA-N |
| XLogP | 3.15 |
| TPSA | 144.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.61 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|