C22H16N6O4S2 — CID 16873575
2-methyl-5-nitro-N-[3-(3-thiophen-2-yl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)phenyl]benzenesulfonamide (PubChem CID 16873575) has the molecular formula C22H16N6O4S2 and a molecular weight of 492.54 g/mol. Its IUPAC name is 2-methyl-5-nitro-N-[3-(3-thiophen-2-yl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)phenyl]benzenesulfonamide.
| Compound Name | 2-methyl-5-nitro-N-[3-(3-thiophen-2-yl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 16873575 |
| Molecular Formula | C22H16N6O4S2 |
| Molecular Weight | 492.54 g/mol |
| Exact Mass | 492.07 |
| IUPAC Name | 2-methyl-5-nitro-N-[3-(3-thiophen-2-yl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)phenyl]benzenesulfonamide |
| SMILES | Cc1ccc([N+](=O)[O-])cc1S(=O)(=O)Nc1cccc(-c2ccc3nnc(-c4cccs4)n3n2)c1 |
| InChI | InChI=1S/C22H16N6O4S2/c1-14-7-8-17(28(29)30)13-20(14)34(31,32)26-16-5-2-4-15(12-16)18-9-10-21-23-24-22(27(21)25-18)19-6-3-11-33-19/h2-13,26H,1H3 |
| InChIKey | IYGKZGAEDBAHTA-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 132.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.54 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|