C22H15N7O4S — CID 16873650
2-nitro-N-[4-(3-pyridin-2-yl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)phenyl]benzenesulfonamide (PubChem CID 16873650) has the molecular formula C22H15N7O4S and a molecular weight of 473.47 g/mol. Its IUPAC name is 2-nitro-N-[4-(3-pyridin-2-yl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)phenyl]benzenesulfonamide.
| Compound Name | 2-nitro-N-[4-(3-pyridin-2-yl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 16873650 |
| Molecular Formula | C22H15N7O4S |
| Molecular Weight | 473.47 g/mol |
| Exact Mass | 473.09 |
| IUPAC Name | 2-nitro-N-[4-(3-pyridin-2-yl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)phenyl]benzenesulfonamide |
| SMILES | O=[N+]([O-])c1ccccc1S(=O)(=O)Nc1ccc(-c2ccc3nnc(-c4ccccn4)n3n2)cc1 |
| InChI | InChI=1S/C22H15N7O4S/c30-29(31)19-6-1-2-7-20(19)34(32,33)27-16-10-8-15(9-11-16)17-12-13-21-24-25-22(28(21)26-17)18-5-3-4-14-23-18/h1-14,27H |
| InChIKey | LHEBQRXVVPHRJW-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 145.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.47 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|