C38H41FIrNO2Se- — CID 168736858
(Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;1-(3,5-dimethylbenzene-6-id-1-yl)-8-fluoro-7-phenyl-[1]benzoselenolo[2,3-c]pyridine;iridium (PubChem CID 168736858) has the molecular formula C38H41FIrNO2Se- and a molecular weight of 833.93 g/mol. Its IUPAC name is (Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;1-(3,5-dimethylbenzene-6-id-1-yl)-8-fluoro-7-phenyl-[1]benzoselenolo[2,3-c]pyridine;iridium.
| Compound Name | (Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;1-(3,5-dimethylbenzene-6-id-1-yl)-8-fluoro-7-phenyl-[1]benzoselenolo[2,3-c]pyridine;iridium |
|---|---|
| PubChem CID | 168736858 |
| Molecular Formula | C38H41FIrNO2Se- |
| Molecular Weight | 833.93 g/mol |
| Exact Mass | 835.19 |
| IUPAC Name | (Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;1-(3,5-dimethylbenzene-6-id-1-yl)-8-fluoro-7-phenyl-[1]benzoselenolo[2,3-c]pyridine;iridium |
| SMILES | CCC(CC)C(=O)/C=C(\O)C(CC)CC.Cc1[c-]c(-c2nccc3c2[se]c2c(F)c(-c4ccccc4)ccc23)cc(C)c1.[Ir] |
| InChI | InChI=1S/C25H17FNSe.C13H24O2.Ir/c1-15-12-16(2)14-18(13-15)23-25-21(10-11-27-23)20-9-8-19(22(26)24(20)28-25)17-6-4-3-5-7-17;1-5-10(6-2)12(14)9-13(15)11(7-3)8-4;/h3-13H,1-2H3;9-11,14H,5-8H2,1-4H3;/q-1;;/b;12-9-; |
| InChIKey | MKDSBKVWQBKJND-DZTQYQPZSA-N |
| XLogP | 10.20 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 833.93 |
| LogP ≤ 5 | 10.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|