C33H36ClN5O5S — CID 168737124
tert-butyl 2-[2-[4-[[2-[(9S)-7-(4-chlorophenyl)-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]acetyl]amino]phenoxy]ethoxy]acetate (PubChem CID 168737124) has the molecular formula C33H36ClN5O5S and a molecular weight of 650.20 g/mol. Its IUPAC name is tert-butyl 2-[2-[4-[[2-[(9S)-7-(4-chlorophenyl)-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]acetyl]amino]phenoxy]ethoxy]acetate.
| Compound Name | tert-butyl 2-[2-[4-[[2-[(9S)-7-(4-chlorophenyl)-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]acetyl]amino]phenoxy]ethoxy]acetate |
|---|---|
| PubChem CID | 168737124 |
| Molecular Formula | C33H36ClN5O5S |
| Molecular Weight | 650.20 g/mol |
| Exact Mass | 649.21 |
| IUPAC Name | tert-butyl 2-[2-[4-[[2-[(9S)-7-(4-chlorophenyl)-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]acetyl]amino]phenoxy]ethoxy]acetate |
| SMILES | Cc1sc2c(c1C)C(c1ccc(Cl)cc1)=N[C@@H](CC(=O)Nc1ccc(OCCOCC(=O)OC(C)(C)C)cc1)c1nnc(C)n1-2 |
| InChI | InChI=1S/C33H36ClN5O5S/c1-19-20(2)45-32-29(19)30(22-7-9-23(34)10-8-22)36-26(31-38-37-21(3)39(31)32)17-27(40)35-24-11-13-25(14-12-24)43-16-15-42-18-28(41)44-33(4,5)6/h7-14,26H,15-18H2,1-6H3,(H,35,40)/t26-/m0/s1 |
| InChIKey | MXDNSKPYTOQTGG-SANMLTNESA-N |
| XLogP | 6.57 |
| TPSA | 116.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.20 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|