C34H39ClN6O5S — CID 168737284
tert-butyl N-[2-[2-[3-[[2-[(9S)-7-(4-chlorophenyl)-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]acetyl]amino]phenoxy]ethoxy]ethyl]carbamate (PubChem CID 168737284) has the molecular formula C34H39ClN6O5S and a molecular weight of 679.24 g/mol. Its IUPAC name is tert-butyl N-[2-[2-[3-[[2-[(9S)-7-(4-chlorophenyl)-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]acetyl]amino]phenoxy]ethoxy]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[2-[3-[[2-[(9S)-7-(4-chlorophenyl)-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]acetyl]amino]phenoxy]ethoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 168737284 |
| Molecular Formula | C34H39ClN6O5S |
| Molecular Weight | 679.24 g/mol |
| Exact Mass | 678.24 |
| IUPAC Name | tert-butyl N-[2-[2-[3-[[2-[(9S)-7-(4-chlorophenyl)-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]acetyl]amino]phenoxy]ethoxy]ethyl]carbamate |
| SMILES | Cc1sc2c(c1C)C(c1ccc(Cl)cc1)=N[C@@H](CC(=O)Nc1cccc(OCCOCCNC(=O)OC(C)(C)C)c1)c1nnc(C)n1-2 |
| InChI | InChI=1S/C34H39ClN6O5S/c1-20-21(2)47-32-29(20)30(23-10-12-24(35)13-11-23)38-27(31-40-39-22(3)41(31)32)19-28(42)37-25-8-7-9-26(18-25)45-17-16-44-15-14-36-33(43)46-34(4,5)6/h7-13,18,27H,14-17,19H2,1-6H3,(H,36,43)(H,37,42)/t27-/m0/s1 |
| InChIKey | DJAVGCPLILPQMS-MHZLTWQESA-N |
| XLogP | 6.75 |
| TPSA | 128.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.24 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|